C19H17N3OS — CID 78098210
6,9-dimethyl-7-sulfanylidene-6,8,11-triazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2(10),12,14,16,18-hexaen-5-one (PubChem CID 78098210) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 6,9-dimethyl-7-sulfanylidene-6,8,11-triazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2(10),12,14,16,18-hexaen-5-one.
| Compound Name | 6,9-dimethyl-7-sulfanylidene-6,8,11-triazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2(10),12,14,16,18-hexaen-5-one |
|---|---|
| PubChem CID | 78098210 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 6,9-dimethyl-7-sulfanylidene-6,8,11-triazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2(10),12,14,16,18-hexaen-5-one |
| SMILES | CC1c2[nH]c3cc4ccccc4cc3c2CC2C(=O)N(C)C(=S)N21 |
| InChI | InChI=1S/C19H17N3OS/c1-10-17-14(9-16-18(23)21(2)19(24)22(10)16)13-7-11-5-3-4-6-12(11)8-15(13)20-17/h3-8,10,16,20H,9H2,1-2H3 |
| InChIKey | UAQYXVNBHYBDNM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|