C15H14ClN3OS — CID 71525232
(10S,15R)-6-chloro-10,13-dimethyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 71525232) has the molecular formula C15H14ClN3OS and a molecular weight of 319.82 g/mol. Its IUPAC name is (10S,15R)-6-chloro-10,13-dimethyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | (10S,15R)-6-chloro-10,13-dimethyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 71525232 |
| Molecular Formula | C15H14ClN3OS |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (10S,15R)-6-chloro-10,13-dimethyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | C[C@H]1c2[nH]c3c(Cl)cccc3c2C[C@@H]2C(=O)N(C)C(=S)N21 |
| InChI | InChI=1S/C15H14ClN3OS/c1-7-12-9(8-4-3-5-10(16)13(8)17-12)6-11-14(20)18(2)15(21)19(7)11/h3-5,7,11,17H,6H2,1-2H3/t7-,11+/m0/s1 |
| InChIKey | SUEOLNNJNNEMMC-WRWORJQWSA-N |
| XLogP | 2.87 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|