C22H31N5OS — CID 19881044
1,3-dimethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-6,8-dihydro-4H-thieno[3,4-b]azepin-5-one (PubChem CID 19881044) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 1,3-dimethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-6,8-dihydro-4H-thieno[3,4-b]azepin-5-one.
| Compound Name | 1,3-dimethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-6,8-dihydro-4H-thieno[3,4-b]azepin-5-one |
|---|---|
| PubChem CID | 19881044 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1,3-dimethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-6,8-dihydro-4H-thieno[3,4-b]azepin-5-one |
| SMILES | CC1=CN(C)C2=C(CSC2)C(=O)C1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H31N5OS/c1-17-14-25(2)20-16-29-15-19(20)21(28)18(17)6-3-4-9-26-10-12-27(13-11-26)22-23-7-5-8-24-22/h5,7-8,14,18H,3-4,6,9-13,15-16H2,1-2H3 |
| InChIKey | BENFBEAHYCPOGC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|