C23H31N5O5S — CID 19881078
2-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one;oxalic acid (PubChem CID 19881078) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one;oxalic acid.
| Compound Name | 2-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one;oxalic acid |
|---|---|
| PubChem CID | 19881078 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one;oxalic acid |
| SMILES | Cc1cc2c(s1)CCCC(=O)N2CCCCN1CCN(c2ncccn2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H29N5OS.C2H2O4/c1-17-16-18-19(28-17)6-4-7-20(27)26(18)11-3-2-10-24-12-14-25(15-13-24)21-22-8-5-9-23-21;3-1(4)2(5)6/h5,8-9,16H,2-4,6-7,10-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OIZWNXWBROGTRQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|