C19H25N5O3S2 — CID 19881143
1,1-dioxo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 19881143) has the molecular formula C19H25N5O3S2 and a molecular weight of 435.58 g/mol. Its IUPAC name is 1,1-dioxo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | 1,1-dioxo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 19881143 |
| Molecular Formula | C19H25N5O3S2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1,1-dioxo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | O=C1c2ccsc2S(=O)(=O)CCN1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H25N5O3S2/c25-17-16-4-14-28-18(16)29(26,27)15-13-23(17)8-2-1-7-22-9-11-24(12-10-22)19-20-5-3-6-21-19/h3-6,14H,1-2,7-13,15H2 |
| InChIKey | FHHKTMRHFKNSJN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|