C18H22N6OS — CID 15718352
6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyridazin-7-one (PubChem CID 15718352) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyridazin-7-one.
| Compound Name | 6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 15718352 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 6-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyridazin-7-one |
| SMILES | O=c1c2sccc2cnn1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H22N6OS/c25-17-16-15(4-13-26-16)14-21-24(17)8-2-1-7-22-9-11-23(12-10-22)18-19-5-3-6-20-18/h3-6,13-14H,1-2,7-12H2 |
| InChIKey | BWCAYPLCSJHZBK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|