C20H21N3O2S — CID 6620003
6-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]thieno[2,3-d]pyridazin-7-one (PubChem CID 6620003) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 6-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]thieno[2,3-d]pyridazin-7-one.
| Compound Name | 6-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]thieno[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 6620003 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 6-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]thieno[2,3-d]pyridazin-7-one |
| SMILES | O=C(Cn1ncc2ccsc2c1=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3O2S/c24-18(14-23-20(25)19-17(13-21-23)8-11-26-19)22-9-6-16(7-10-22)12-15-4-2-1-3-5-15/h1-5,8,11,13,16H,6-7,9-10,12,14H2 |
| InChIKey | NBSFCTBWTHHEBJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |