C24H26ClN3O2S — CID 67836671
2-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]isoindole-1,3-dione;hydrochloride (PubChem CID 67836671) has the molecular formula C24H26ClN3O2S and a molecular weight of 456.01 g/mol. Its IUPAC name is 2-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 67836671 |
| Molecular Formula | C24H26ClN3O2S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1CCCCN1CCN(c2csc3ccccc23)CC1 |
| InChI | InChI=1S/C24H25N3O2S.ClH/c28-23-18-7-1-2-8-19(18)24(29)27(23)12-6-5-11-25-13-15-26(16-14-25)21-17-30-22-10-4-3-9-20(21)22;/h1-4,7-10,17H,5-6,11-16H2;1H |
| InChIKey | FWBOXOKDYGUEMQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|