C35H43N3O6 — CID 162332739
(E)-but-2-enedioic acid;N-[3-[4-[2-(1-methoxypropyl)phenyl]piperazin-1-yl]propyl]-2,2-diphenylacetamide (PubChem CID 162332739) has the molecular formula C35H43N3O6 and a molecular weight of 601.74 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[3-[4-[2-(1-methoxypropyl)phenyl]piperazin-1-yl]propyl]-2,2-diphenylacetamide.
| Compound Name | (E)-but-2-enedioic acid;N-[3-[4-[2-(1-methoxypropyl)phenyl]piperazin-1-yl]propyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 162332739 |
| Molecular Formula | C35H43N3O6 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[3-[4-[2-(1-methoxypropyl)phenyl]piperazin-1-yl]propyl]-2,2-diphenylacetamide |
| SMILES | CCC(OC)c1ccccc1N1CCN(CCCNC(=O)C(c2ccccc2)c2ccccc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C31H39N3O2.C4H4O4/c1-3-29(36-2)27-17-10-11-18-28(27)34-23-21-33(22-24-34)20-12-19-32-31(35)30(25-13-6-4-7-14-25)26-15-8-5-9-16-26;5-3(6)1-2-4(7)8/h4-11,13-18,29-30H,3,12,19-24H2,1-2H3,(H,32,35);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KVYIXTIZLDBHLS-WLHGVMLRSA-N |
| XLogP | 4.96 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|