C15H18N4O3S2 — CID 7399813
(2S)-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide (PubChem CID 7399813) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (2S)-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide.
| Compound Name | (2S)-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide |
|---|---|
| PubChem CID | 7399813 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2S)-2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide |
| SMILES | COc1ccccc1Nc1nnc(S[C@@H](C(C)=O)C(=O)N(C)C)s1 |
| InChI | InChI=1S/C15H18N4O3S2/c1-9(20)12(13(21)19(2)3)23-15-18-17-14(24-15)16-10-7-5-6-8-11(10)22-4/h5-8,12H,1-4H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | BUFHFBNKVLZRKL-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|