C14H15N3O2S2 — CID 3511764
3-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentane-2,4-dione (PubChem CID 3511764) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentane-2,4-dione.
| Compound Name | 3-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 3511764 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-[[5-(2-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentane-2,4-dione |
| SMILES | CC(=O)C(Sc1nnc(Nc2ccccc2C)s1)C(C)=O |
| InChI | InChI=1S/C14H15N3O2S2/c1-8-6-4-5-7-11(8)15-13-16-17-14(21-13)20-12(9(2)18)10(3)19/h4-7,12H,1-3H3,(H,15,16) |
| InChIKey | JMADEQKSWNWKLF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|