C17H18N4O2S2 — CID 23855975
2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 23855975) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 23855975 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCSc1nnc(NC(=O)Cc2nc(-c3ccccc3)oc2C)s1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-3-9-24-17-21-20-16(25-17)19-14(22)10-13-11(2)23-15(18-13)12-7-5-4-6-8-12/h4-8H,3,9-10H2,1-2H3,(H,19,20,22) |
| InChIKey | CLVGRHKOXPAOBD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|