C11H13N3OS2 — CID 18282914
(2E,4E)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide (PubChem CID 18282914) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is (2E,4E)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 18282914 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (2E,4E)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide |
| SMILES | C=CCSc1nnc(NC(=O)/C=C/C=C/C)s1 |
| InChI | InChI=1S/C11H13N3OS2/c1-3-5-6-7-9(15)12-10-13-14-11(17-10)16-8-4-2/h3-7H,2,8H2,1H3,(H,12,13,15)/b5-3+,7-6+ |
| InChIKey | BWGFMCNKQHMJQN-TWTPFVCWSA-N |
| XLogP | 2.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|