C11H6F5N3OS — CID 16574832
N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 16574832) has the molecular formula C11H6F5N3OS and a molecular weight of 323.25 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 16574832 |
| Molecular Formula | C11H6F5N3OS |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | Cc1nnc(NC(=O)Cc2c(F)c(F)c(F)c(F)c2F)s1 |
| InChI | InChI=1S/C11H6F5N3OS/c1-3-18-19-11(21-3)17-5(20)2-4-6(12)8(14)10(16)9(15)7(4)13/h2H2,1H3,(H,17,19,20) |
| InChIKey | HUICNHVUAPOSGE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|