C12H21N3OS — CID 5078577
N-(5-methyl-1,3,4-thiadiazol-2-yl)nonanamide (PubChem CID 5078577) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)nonanamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)nonanamide |
|---|---|
| PubChem CID | 5078577 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)nonanamide |
| SMILES | CCCCCCCCC(=O)Nc1nnc(C)s1 |
| InChI | InChI=1S/C12H21N3OS/c1-3-4-5-6-7-8-9-11(16)13-12-15-14-10(2)17-12/h3-9H2,1-2H3,(H,13,15,16) |
| InChIKey | ACASJJUEAJVEBT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|