C6H10N4OS — CID 21417198
1-ethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 21417198) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 1-ethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-ethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 21417198 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 1-ethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCNC(=O)Nc1nnc(C)s1 |
| InChI | InChI=1S/C6H10N4OS/c1-3-7-5(11)8-6-10-9-4(2)12-6/h3H2,1-2H3,(H2,7,8,10,11) |
| InChIKey | HBEAJJCKJUCCTN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |