C25H23N5O — CID 67062397
1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-[(4-methylphenyl)methyl]urea (PubChem CID 67062397) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 67062397 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)Nc2cc(-c3ccnc(Nc4ccccc4)c3)ccn2)cc1 |
| InChI | InChI=1S/C25H23N5O/c1-18-7-9-19(10-8-18)17-28-25(31)30-24-16-21(12-14-27-24)20-11-13-26-23(15-20)29-22-5-3-2-4-6-22/h2-16H,17H2,1H3,(H,26,29)(H2,27,28,30,31) |
| InChIKey | PNLLMNJINQNEPH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |