hydrazine;pyridine-2,4-dicarboxylic acid

C7H9N3O4 — CID 71369189

IUPAChydrazine;pyridine-2,4-dicarboxylic acid
SMILESNN.O=C(O)c1ccnc(C(=O)O)c1
InChIInChI=1S/C7H5NO4.H4N2/c9-6(10)4-1-2-8-5(3-4)7(11)12;1-2/h1-3H,(H,9,10)(H,11,12);1-2H2
InChIKeyDQSPJLCADDJZIA-UHFFFAOYSA-N
MW199.17 g/mol
LogP-0.70
Rot. Bonds2

About hydrazine;pyridine-2,4-dicarboxylic acid

hydrazine;pyridine-2,4-dicarboxylic acid (PubChem CID 71369189) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is hydrazine;pyridine-2,4-dicarboxylic acid.

Molecular Properties

Compound Namehydrazine;pyridine-2,4-dicarboxylic acid
PubChem CID71369189
Molecular FormulaC7H9N3O4
Molecular Weight199.17 g/mol
Exact Mass199.06
IUPAC Namehydrazine;pyridine-2,4-dicarboxylic acid
SMILESNN.O=C(O)c1ccnc(C(=O)O)c1
InChIInChI=1S/C7H5NO4.H4N2/c9-6(10)4-1-2-8-5(3-4)7(11)12;1-2/h1-3H,(H,9,10)(H,11,12);1-2H2
InChIKeyDQSPJLCADDJZIA-UHFFFAOYSA-N
XLogP-0.70
TPSA139.53 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.17
LogP ≤ 5-0.70
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze hydrazine;pyridine-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazine;pyridine-2,4-dicarboxylic acid?
The IUPAC name of hydrazine;pyridine-2,4-dicarboxylic acid (CID 71369189) is hydrazine;pyridine-2,4-dicarboxylic acid.
What is the SMILES notation for hydrazine;pyridine-2,4-dicarboxylic acid?
The canonical SMILES for hydrazine;pyridine-2,4-dicarboxylic acid is NN.O=C(O)c1ccnc(C(=O)O)c1.
What is the InChIKey of hydrazine;pyridine-2,4-dicarboxylic acid?
The InChIKey is DQSPJLCADDJZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.H4N2/c9-6(10)4-1-2-8-5(3-4)7(11)12;1-2/h1-3H,(H,9,10)(H,11,12);1-2H2.
What are the key properties of hydrazine;pyridine-2,4-dicarboxylic acid?
hydrazine;pyridine-2,4-dicarboxylic acid has a molecular weight of 199.17 g/mol, XLogP of -0.70, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;pyridine-2,4-dicarboxylic acid is sourced from PubChem (CID 71369189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).