C12H10N2O4 — CID 159305579
pyridine;pyridine-2,4-dicarboxylic acid (PubChem CID 159305579) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is pyridine;pyridine-2,4-dicarboxylic acid.
| Compound Name | pyridine;pyridine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 159305579 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | pyridine;pyridine-2,4-dicarboxylic acid |
| SMILES | O=C(O)c1ccnc(C(=O)O)c1.c1ccncc1 |
| InChI | InChI=1S/C7H5NO4.C5H5N/c9-6(10)4-1-2-8-5(3-4)7(11)12;1-2-4-6-5-3-1/h1-3H,(H,9,10)(H,11,12);1-5H |
| InChIKey | LBWLDCFFDAQNHH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |