About 4-aminopyridine-2-carboxylic acid;ethane
4-aminopyridine-2-carboxylic acid;ethane (PubChem CID 91192468) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-aminopyridine-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 4-aminopyridine-2-carboxylic acid;ethane |
| PubChem CID | 91192468 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4-aminopyridine-2-carboxylic acid;ethane |
| SMILES | CC.Nc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C6H6N2O2.C2H6/c7-4-1-2-8-5(3-4)6(9)10;1-2/h1-3H,(H2,7,8)(H,9,10);1-2H3 |
| InChIKey | MONUKXAMVUULHX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminopyridine-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyridine-2-carboxylic acid;ethane?
The IUPAC name of 4-aminopyridine-2-carboxylic acid;ethane (CID 91192468) is 4-aminopyridine-2-carboxylic acid;ethane.
What is the SMILES notation for 4-aminopyridine-2-carboxylic acid;ethane?
The canonical SMILES for 4-aminopyridine-2-carboxylic acid;ethane is CC.Nc1ccnc(C(=O)O)c1.
What is the InChIKey of 4-aminopyridine-2-carboxylic acid;ethane?
The InChIKey is MONUKXAMVUULHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.C2H6/c7-4-1-2-8-5(3-4)6(9)10;1-2/h1-3H,(H2,7,8)(H,9,10);1-2H3.
What are the key properties of 4-aminopyridine-2-carboxylic acid;ethane?
4-aminopyridine-2-carboxylic acid;ethane has a molecular weight of 168.20 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyridine-2-carboxylic acid;ethane is sourced from PubChem (CID 91192468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).