C12H8BrN3O3 — CID 114037370
2-[(2-bromopyridine-4-carbonyl)amino]pyridine-4-carboxylic acid (PubChem CID 114037370) has the molecular formula C12H8BrN3O3 and a molecular weight of 322.12 g/mol. Its IUPAC name is 2-[(2-bromopyridine-4-carbonyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-[(2-bromopyridine-4-carbonyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114037370 |
| Molecular Formula | C12H8BrN3O3 |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 2-[(2-bromopyridine-4-carbonyl)amino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NC(=O)c2ccnc(Br)c2)c1 |
| InChI | InChI=1S/C12H8BrN3O3/c13-9-5-7(1-3-14-9)11(17)16-10-6-8(12(18)19)2-4-15-10/h1-6H,(H,18,19)(H,15,16,17) |
| InChIKey | VQGLWNHZSQGPKU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|