C13H10N2O5 — CID 136903643
2-[(2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylic acid (PubChem CID 136903643) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-[(2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-[(2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 136903643 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[(2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NC(=O)c2cc(O)ccc2O)c1 |
| InChI | InChI=1S/C13H10N2O5/c16-8-1-2-10(17)9(6-8)12(18)15-11-5-7(13(19)20)3-4-14-11/h1-6,16-17H,(H,19,20)(H,14,15,18) |
| InChIKey | UUEYCHBKSADWQJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|