About 2-ethenylpteridine
2-ethenylpteridine (PubChem CID 22062458) has the molecular formula C8H6N4
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-ethenylpteridine.
Molecular Properties
| Compound Name | 2-ethenylpteridine |
| PubChem CID | 22062458 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-ethenylpteridine |
| SMILES | C=Cc1ncc2nccnc2n1 |
| InChI | InChI=1S/C8H6N4/c1-2-7-11-5-6-8(12-7)10-4-3-9-6/h2-5H,1H2 |
| InChIKey | TWRWWJLXMBKRSU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethenylpteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpteridine?
The IUPAC name of 2-ethenylpteridine (CID 22062458) is 2-ethenylpteridine.
What is the SMILES notation for 2-ethenylpteridine?
The canonical SMILES for 2-ethenylpteridine is C=Cc1ncc2nccnc2n1.
What is the InChIKey of 2-ethenylpteridine?
The InChIKey is TWRWWJLXMBKRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4/c1-2-7-11-5-6-8(12-7)10-4-3-9-6/h2-5H,1H2.
What are the key properties of 2-ethenylpteridine?
2-ethenylpteridine has a molecular weight of 158.16 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpteridine is sourced from PubChem (CID 22062458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).