About dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine
dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine (PubChem CID 67035770) has the molecular formula C7H8N4O3P+
and a molecular weight of 227.14 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine |
| PubChem CID | 67035770 |
| Molecular Formula | C7H8N4O3P+ |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine |
| SMILES | C=Cc1ncc2[nH]cnc2n1.O=[P+](O)O |
| InChI | InChI=1S/C7H6N4.HO3P/c1-2-6-8-3-5-7(11-6)10-4-9-5;1-4(2)3/h2-4H,1H2,(H,8,9,10,11);(H-,1,2,3)/p+1 |
| InChIKey | FSKCLKUCWXCSKO-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine?
The IUPAC name of dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine (CID 67035770) is dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine.
What is the SMILES notation for dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine?
The canonical SMILES for dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine is C=Cc1ncc2[nH]cnc2n1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine?
The InChIKey is FSKCLKUCWXCSKO-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6N4.HO3P/c1-2-6-8-3-5-7(11-6)10-4-9-5;1-4(2)3/h2-4H,1H2,(H,8,9,10,11);(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine?
dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine has a molecular weight of 227.14 g/mol, XLogP of 0.62, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;2-ethenyl-7H-purine is sourced from PubChem (CID 67035770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).