About 7H-purine-2-sulfonamide
7H-purine-2-sulfonamide (PubChem CID 3276405) has the molecular formula C5H5N5O2S
and a molecular weight of 199.19 g/mol. Its IUPAC name is 7H-purine-2-sulfonamide.
Molecular Properties
| Compound Name | 7H-purine-2-sulfonamide |
| PubChem CID | 3276405 |
| Molecular Formula | C5H5N5O2S |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 7H-purine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H5N5O2S/c6-13(11,12)5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H2,6,11,12)(H,7,8,9,10) |
| InChIKey | RNEYXABXOHUZGF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7H-purine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine-2-sulfonamide?
The IUPAC name of 7H-purine-2-sulfonamide (CID 3276405) is 7H-purine-2-sulfonamide.
What is the SMILES notation for 7H-purine-2-sulfonamide?
The canonical SMILES for 7H-purine-2-sulfonamide is NS(=O)(=O)c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine-2-sulfonamide?
The InChIKey is RNEYXABXOHUZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O2S/c6-13(11,12)5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H2,6,11,12)(H,7,8,9,10).
What are the key properties of 7H-purine-2-sulfonamide?
7H-purine-2-sulfonamide has a molecular weight of 199.19 g/mol, XLogP of -1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-2-sulfonamide is sourced from PubChem (CID 3276405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).