About 2-chloro-7H-purine;hydrobromide
2-chloro-7H-purine;hydrobromide (PubChem CID 172776309) has the molecular formula C5H4BrClN4
and a molecular weight of 235.47 g/mol. Its IUPAC name is 2-chloro-7H-purine;hydrobromide.
Molecular Properties
| Compound Name | 2-chloro-7H-purine;hydrobromide |
| PubChem CID | 172776309 |
| Molecular Formula | C5H4BrClN4 |
| Molecular Weight | 235.47 g/mol |
| Exact Mass | 233.93 |
| IUPAC Name | 2-chloro-7H-purine;hydrobromide |
| SMILES | Br.Clc1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H3ClN4.BrH/c6-5-7-1-3-4(10-5)9-2-8-3;/h1-2H,(H,7,8,9,10);1H |
| InChIKey | NQIFRIWPINVUFW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-7H-purine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7H-purine;hydrobromide?
The IUPAC name of 2-chloro-7H-purine;hydrobromide (CID 172776309) is 2-chloro-7H-purine;hydrobromide.
What is the SMILES notation for 2-chloro-7H-purine;hydrobromide?
The canonical SMILES for 2-chloro-7H-purine;hydrobromide is Br.Clc1ncc2[nH]cnc2n1.
What is the InChIKey of 2-chloro-7H-purine;hydrobromide?
The InChIKey is NQIFRIWPINVUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4.BrH/c6-5-7-1-3-4(10-5)9-2-8-3;/h1-2H,(H,7,8,9,10);1H.
What are the key properties of 2-chloro-7H-purine;hydrobromide?
2-chloro-7H-purine;hydrobromide has a molecular weight of 235.47 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7H-purine;hydrobromide is sourced from PubChem (CID 172776309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).