About 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol
1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol (PubChem CID 70391878) has the molecular formula C8H8Cl2N4O2
and a molecular weight of 263.08 g/mol. Its IUPAC name is 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol.
Molecular Properties
| Compound Name | 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol |
| PubChem CID | 70391878 |
| Molecular Formula | C8H8Cl2N4O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol |
| SMILES | CC(O)(O)C(Cl)(Cl)c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C8H8Cl2N4O2/c1-7(15,16)8(9,10)6-11-2-4-5(14-6)13-3-12-4/h2-3,15-16H,1H3,(H,11,12,13,14) |
| InChIKey | KTKRSQJHWSHQBM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol?
The IUPAC name of 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol (CID 70391878) is 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol.
What is the SMILES notation for 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol?
The canonical SMILES for 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol is CC(O)(O)C(Cl)(Cl)c1ncc2[nH]cnc2n1.
What is the InChIKey of 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol?
The InChIKey is KTKRSQJHWSHQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N4O2/c1-7(15,16)8(9,10)6-11-2-4-5(14-6)13-3-12-4/h2-3,15-16H,1H3,(H,11,12,13,14).
What are the key properties of 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol?
1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol has a molecular weight of 263.08 g/mol, XLogP of 0.68, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-1-(7H-purin-2-yl)propane-2,2-diol is sourced from PubChem (CID 70391878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).