About 7H-purine-2-carbonitrile;hydrochloride
7H-purine-2-carbonitrile;hydrochloride (PubChem CID 162321507) has the molecular formula C6H4ClN5
and a molecular weight of 181.59 g/mol. Its IUPAC name is 7H-purine-2-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 7H-purine-2-carbonitrile;hydrochloride |
| PubChem CID | 162321507 |
| Molecular Formula | C6H4ClN5 |
| Molecular Weight | 181.59 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 7H-purine-2-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C6H3N5.ClH/c7-1-5-8-2-4-6(11-5)10-3-9-4;/h2-3H,(H,8,9,10,11);1H |
| InChIKey | PCPYYYFHONKUAO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.59 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7H-purine-2-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine-2-carbonitrile;hydrochloride?
The IUPAC name of 7H-purine-2-carbonitrile;hydrochloride (CID 162321507) is 7H-purine-2-carbonitrile;hydrochloride.
What is the SMILES notation for 7H-purine-2-carbonitrile;hydrochloride?
The canonical SMILES for 7H-purine-2-carbonitrile;hydrochloride is Cl.N#Cc1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine-2-carbonitrile;hydrochloride?
The InChIKey is PCPYYYFHONKUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5.ClH/c7-1-5-8-2-4-6(11-5)10-3-9-4;/h2-3H,(H,8,9,10,11);1H.
What are the key properties of 7H-purine-2-carbonitrile;hydrochloride?
7H-purine-2-carbonitrile;hydrochloride has a molecular weight of 181.59 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-2-carbonitrile;hydrochloride is sourced from PubChem (CID 162321507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).