About 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine
2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine (PubChem CID 159573001) has the molecular formula C10H8Cl2N10
and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine.
Molecular Properties
| Compound Name | 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine |
| PubChem CID | 159573001 |
| Molecular Formula | C10H8Cl2N10 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine |
| SMILES | Nc1nc(Cl)nc2nc[nH]c12.Nc1nc2nc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/2C5H4ClN5/c6-5-10-3(7)2-4(11-5)9-1-8-2;6-4-8-1-2-3(10-4)11-5(7)9-2/h2*1H,(H3,7,8,9,10,11) |
| InChIKey | MIBCTNGJAOGXJP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine?
The IUPAC name of 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine (CID 159573001) is 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine.
What is the SMILES notation for 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine?
The canonical SMILES for 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine is Nc1nc(Cl)nc2nc[nH]c12.Nc1nc2nc(Cl)ncc2[nH]1.
What is the InChIKey of 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine?
The InChIKey is MIBCTNGJAOGXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H4ClN5/c6-5-10-3(7)2-4(11-5)9-1-8-2;6-4-8-1-2-3(10-4)11-5(7)9-2/h2*1H,(H3,7,8,9,10,11).
What are the key properties of 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine?
2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine has a molecular weight of 339.15 g/mol, XLogP of 1.18, 0 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7H-purin-6-amine;2-chloro-7H-purin-8-amine is sourced from PubChem (CID 159573001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).