C5H6N5PtSe+2 — CID 71440216
CID 71440216 (PubChem CID 71440216) has the molecular formula C5H6N5PtSe+2 and a molecular weight of 410.18 g/mol.
| Compound Name | CID 71440216 |
|---|---|
| PubChem CID | 71440216 |
| Molecular Formula | C5H6N5PtSe+2 |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | — |
| SMILES | [H]/[Se]=c1\[nH]c(N)nc2nc[nH]c12.[Pt+2] |
| InChI | InChI=1S/C5H6N5Se.Pt/c6-5-9-3-2(4(11)10-5)7-1-8-3;/h1,11H,(H,7,8)(H3,6,9,10);/q;+2 |
| InChIKey | CNPDHTPKGMGUIR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|