About 6-amino-1,7-dihydropurin-2-one;hydrochloride
6-amino-1,7-dihydropurin-2-one;hydrochloride (PubChem CID 67634855) has the molecular formula C5H6ClN5O
and a molecular weight of 187.59 g/mol. Its IUPAC name is 6-amino-1,7-dihydropurin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-1,7-dihydropurin-2-one;hydrochloride |
| PubChem CID | 67634855 |
| Molecular Formula | C5H6ClN5O |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 6-amino-1,7-dihydropurin-2-one;hydrochloride |
| SMILES | Cl.Nc1[nH]c(=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5O.ClH/c6-3-2-4(8-1-7-2)10-5(11)9-3;/h1H,(H4,6,7,8,9,10,11);1H |
| InChIKey | ZYZFWYNPVAKGEO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-1,7-dihydropurin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,7-dihydropurin-2-one;hydrochloride?
The IUPAC name of 6-amino-1,7-dihydropurin-2-one;hydrochloride (CID 67634855) is 6-amino-1,7-dihydropurin-2-one;hydrochloride.
What is the SMILES notation for 6-amino-1,7-dihydropurin-2-one;hydrochloride?
The canonical SMILES for 6-amino-1,7-dihydropurin-2-one;hydrochloride is Cl.Nc1[nH]c(=O)nc2nc[nH]c12.
What is the InChIKey of 6-amino-1,7-dihydropurin-2-one;hydrochloride?
The InChIKey is ZYZFWYNPVAKGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O.ClH/c6-3-2-4(8-1-7-2)10-5(11)9-3;/h1H,(H4,6,7,8,9,10,11);1H.
What are the key properties of 6-amino-1,7-dihydropurin-2-one;hydrochloride?
6-amino-1,7-dihydropurin-2-one;hydrochloride has a molecular weight of 187.59 g/mol, XLogP of -0.35, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,7-dihydropurin-2-one;hydrochloride is sourced from PubChem (CID 67634855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).