C5H6ClN5O — CID 67634855
6-amino-1,7-dihydropurin-2-one;hydrochloride (PubChem CID 67634855) has the molecular formula C5H6ClN5O and a molecular weight of 187.59 g/mol. Its IUPAC name is 6-amino-1,7-dihydropurin-2-one;hydrochloride.
| Compound Name | 6-amino-1,7-dihydropurin-2-one;hydrochloride |
|---|---|
| PubChem CID | 67634855 |
| Molecular Formula | C5H6ClN5O |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 6-amino-1,7-dihydropurin-2-one;hydrochloride |
| SMILES | Cl.Nc1[nH]c(=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5O.ClH/c6-3-2-4(8-1-7-2)10-5(11)9-3;/h1H,(H4,6,7,8,9,10,11);1H |
| InChIKey | ZYZFWYNPVAKGEO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |