C5H3KN4O2 — CID 170844848
potassium 2-oxo-1,7-dihydropurin-6-olate (PubChem CID 170844848) has the molecular formula C5H3KN4O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is potassium 2-oxo-1,7-dihydropurin-6-olate.
| Compound Name | potassium 2-oxo-1,7-dihydropurin-6-olate |
|---|---|
| PubChem CID | 170844848 |
| Molecular Formula | C5H3KN4O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | potassium 2-oxo-1,7-dihydropurin-6-olate |
| SMILES | O=c1nc2nc[nH]c2c([O-])[nH]1.[K+] |
| InChI | InChI=1S/C5H4N4O2.K/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H3,6,7,8,9,10,11);/q;+1/p-1 |
| InChIKey | VWBWAALEWBNEIR-UHFFFAOYSA-M |
| XLogP | -4.28 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |