C6H3F3N4O — CID 119082939
6-(trifluoromethyl)-1,7-dihydropurin-2-one (PubChem CID 119082939) has the molecular formula C6H3F3N4O and a molecular weight of 204.11 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,7-dihydropurin-2-one.
| Compound Name | 6-(trifluoromethyl)-1,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 119082939 |
| Molecular Formula | C6H3F3N4O |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 6-(trifluoromethyl)-1,7-dihydropurin-2-one |
| SMILES | O=c1nc2nc[nH]c2c(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C6H3F3N4O/c7-6(8,9)3-2-4(11-1-10-2)13-5(14)12-3/h1H,(H2,10,11,12,13,14) |
| InChIKey | YEFQKORDUJWJEO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |