C5H6N6O — CID 15628862
1,2-diamino-7H-purin-6-one (PubChem CID 15628862) has the molecular formula C5H6N6O and a molecular weight of 166.14 g/mol. Its IUPAC name is 1,2-diamino-7H-purin-6-one.
| Compound Name | 1,2-diamino-7H-purin-6-one |
|---|---|
| PubChem CID | 15628862 |
| Molecular Formula | C5H6N6O |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 1,2-diamino-7H-purin-6-one |
| SMILES | Nc1nc2nc[nH]c2c(=O)n1N |
| InChI | InChI=1S/C5H6N6O/c6-5-10-3-2(8-1-9-3)4(12)11(5)7/h1H,7H2,(H2,6,10)(H,8,9) |
| InChIKey | SXOXZTOVXLRUQY-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |