C13H13N5O — CID 123912992
2-amino-1-(2,4-dimethylphenyl)-7H-purin-6-one (PubChem CID 123912992) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-amino-1-(2,4-dimethylphenyl)-7H-purin-6-one.
| Compound Name | 2-amino-1-(2,4-dimethylphenyl)-7H-purin-6-one |
|---|---|
| PubChem CID | 123912992 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-amino-1-(2,4-dimethylphenyl)-7H-purin-6-one |
| SMILES | Cc1ccc(-n2c(N)nc3nc[nH]c3c2=O)c(C)c1 |
| InChI | InChI=1S/C13H13N5O/c1-7-3-4-9(8(2)5-7)18-12(19)10-11(16-6-15-10)17-13(18)14/h3-6H,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | NRXYFHJEPIUKIH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |