C11H14N6O3 — CID 19757652
1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one (PubChem CID 19757652) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one.
| Compound Name | 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one |
|---|---|
| PubChem CID | 19757652 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one |
| SMILES | CC(=O)n1c(N)nc2nc[nH]c2c1=O.O=C1CCCN1 |
| InChI | InChI=1S/C7H7N5O2.C4H7NO/c1-3(13)12-6(14)4-5(10-2-9-4)11-7(12)8;6-4-2-1-3-5-4/h2H,1H3,(H2,8,11)(H,9,10);1-3H2,(H,5,6) |
| InChIKey | JZLUBKMQNHRSJH-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |