About 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one
1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one (PubChem CID 19757652) has the molecular formula C11H14N6O3
and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one |
| PubChem CID | 19757652 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one |
| SMILES | CC(=O)n1c(N)nc2nc[nH]c2c1=O.O=C1CCCN1 |
| InChI | InChI=1S/C7H7N5O2.C4H7NO/c1-3(13)12-6(14)4-5(10-2-9-4)11-7(12)8;6-4-2-1-3-5-4/h2H,1H3,(H2,8,11)(H,9,10);1-3H2,(H,5,6) |
| InChIKey | JZLUBKMQNHRSJH-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one?
The IUPAC name of 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one (CID 19757652) is 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one.
What is the SMILES notation for 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one?
The canonical SMILES for 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one is CC(=O)n1c(N)nc2nc[nH]c2c1=O.O=C1CCCN1.
What is the InChIKey of 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one?
The InChIKey is JZLUBKMQNHRSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O2.C4H7NO/c1-3(13)12-6(14)4-5(10-2-9-4)11-7(12)8;6-4-2-1-3-5-4/h2H,1H3,(H2,8,11)(H,9,10);1-3H2,(H,5,6).
What are the key properties of 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one?
1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one has a molecular weight of 278.27 g/mol, XLogP of -0.74, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2-amino-7H-purin-6-one;pyrrolidin-2-one is sourced from PubChem (CID 19757652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).