About bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate
bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate (PubChem CID 67908400) has the molecular formula C10H12N10O5
and a molecular weight of 352.27 g/mol. Its IUPAC name is bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate.
Molecular Properties
| Compound Name | bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate |
| PubChem CID | 67908400 |
| Molecular Formula | C10H12N10O5 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate |
| SMILES | Nc1nc2nc[nH]c2c(=O)n1O.Nc1nc2nc[nH]c2c(=O)n1O.O |
| InChI | InChI=1S/2C5H5N5O2.H2O/c2*6-5-9-3-2(7-1-8-3)4(11)10(5)12;/h2*1,12H,(H2,6,9)(H,7,8);1H2 |
| InChIKey | ROZIZPFBUWTFIH-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 251.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate?
The IUPAC name of bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate (CID 67908400) is bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate.
What is the SMILES notation for bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate?
The canonical SMILES for bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate is Nc1nc2nc[nH]c2c(=O)n1O.Nc1nc2nc[nH]c2c(=O)n1O.O.
What is the InChIKey of bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate?
The InChIKey is ROZIZPFBUWTFIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5N5O2.H2O/c2*6-5-9-3-2(7-1-8-3)4(11)10(5)12;/h2*1,12H,(H2,6,9)(H,7,8);1H2.
What are the key properties of bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate?
bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate has a molecular weight of 352.27 g/mol, XLogP of -2.95, 0 rotatable bonds, 6 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-amino-1-hydroxy-7H-purin-6-one);hydrate is sourced from PubChem (CID 67908400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).