C10H13N5O3 — CID 69471495
2-amino-1-(1-cyclopropyl-2,2-dihydroxyethyl)-7H-purin-6-one (PubChem CID 69471495) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-amino-1-(1-cyclopropyl-2,2-dihydroxyethyl)-7H-purin-6-one.
| Compound Name | 2-amino-1-(1-cyclopropyl-2,2-dihydroxyethyl)-7H-purin-6-one |
|---|---|
| PubChem CID | 69471495 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-amino-1-(1-cyclopropyl-2,2-dihydroxyethyl)-7H-purin-6-one |
| SMILES | Nc1nc2nc[nH]c2c(=O)n1C(C(O)O)C1CC1 |
| InChI | InChI=1S/C10H13N5O3/c11-10-14-7-5(12-3-13-7)8(16)15(10)6(9(17)18)4-1-2-4/h3-4,6,9,17-18H,1-2H2,(H2,11,14)(H,12,13) |
| InChIKey | HRTJRUCEIIOPPD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|