C12H18N6O — CID 118455615
2-amino-1-(2-piperidin-1-ylethyl)-7H-purin-6-one (PubChem CID 118455615) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-amino-1-(2-piperidin-1-ylethyl)-7H-purin-6-one.
| Compound Name | 2-amino-1-(2-piperidin-1-ylethyl)-7H-purin-6-one |
|---|---|
| PubChem CID | 118455615 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-amino-1-(2-piperidin-1-ylethyl)-7H-purin-6-one |
| SMILES | Nc1nc2nc[nH]c2c(=O)n1CCN1CCCCC1 |
| InChI | InChI=1S/C12H18N6O/c13-12-16-10-9(14-8-15-10)11(19)18(12)7-6-17-4-2-1-3-5-17/h8H,1-7H2,(H2,13,16)(H,14,15) |
| InChIKey | NUBAQMFDGGORJS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |