C7H9N5O2 — CID 174590702
2-amino-1-ethoxy-7H-purin-6-one (PubChem CID 174590702) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-amino-1-ethoxy-7H-purin-6-one.
| Compound Name | 2-amino-1-ethoxy-7H-purin-6-one |
|---|---|
| PubChem CID | 174590702 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-amino-1-ethoxy-7H-purin-6-one |
| SMILES | CCOn1c(N)nc2nc[nH]c2c1=O |
| InChI | InChI=1S/C7H9N5O2/c1-2-14-12-6(13)4-5(10-3-9-4)11-7(12)8/h3H,2H2,1H3,(H2,8,11)(H,9,10) |
| InChIKey | QKUBDEOBKBIHGH-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |