C7H7N5O3 — CID 137201360
ethyl 4-oxo-5H-imidazo[4,5-d]triazine-3-carboxylate (PubChem CID 137201360) has the molecular formula C7H7N5O3 and a molecular weight of 209.16 g/mol. Its IUPAC name is ethyl 4-oxo-5H-imidazo[4,5-d]triazine-3-carboxylate.
| Compound Name | ethyl 4-oxo-5H-imidazo[4,5-d]triazine-3-carboxylate |
|---|---|
| PubChem CID | 137201360 |
| Molecular Formula | C7H7N5O3 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | ethyl 4-oxo-5H-imidazo[4,5-d]triazine-3-carboxylate |
| SMILES | CCOC(=O)n1nnc2nc[nH]c2c1=O |
| InChI | InChI=1S/C7H7N5O3/c1-2-15-7(14)12-6(13)4-5(10-11-12)9-3-8-4/h3H,2H2,1H3,(H,8,9) |
| InChIKey | LAMLETCIJLHYDY-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |