About CID 174095439
CID 174095439 (PubChem CID 174095439) has the molecular formula C7H4BN3
and a molecular weight of 140.94 g/mol.
Molecular Properties
| Compound Name | CID 174095439 |
| PubChem CID | 174095439 |
| Molecular Formula | C7H4BN3 |
| Molecular Weight | 140.94 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2nccnc2c1 |
| InChI | InChI=1S/C7H4BN3/c8-5-3-6-7(11-4-5)10-2-1-9-6/h1-4H |
| InChIKey | AXUPYPRENICGGG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.94 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174095439 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174095439?
The IUPAC name of CID 174095439 (CID 174095439) is not available.
What is the SMILES notation for CID 174095439?
The canonical SMILES for CID 174095439 is [B]c1cnc2nccnc2c1.
What is the InChIKey of CID 174095439?
The InChIKey is AXUPYPRENICGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BN3/c8-5-3-6-7(11-4-5)10-2-1-9-6/h1-4H.
What are the key properties of CID 174095439?
CID 174095439 has a molecular weight of 140.94 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174095439 is sourced from PubChem (CID 174095439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).