About 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine
3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine (PubChem CID 166898130) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine |
| PubChem CID | 166898130 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine |
| SMILES | Cc1cnc2c(C)onc2n1 |
| InChI | InChI=1S/C7H7N3O/c1-4-3-8-6-5(2)11-10-7(6)9-4/h3H,1-2H3 |
| InChIKey | BKTCFJUNKXPNEU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine?
The IUPAC name of 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine (CID 166898130) is 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine.
What is the SMILES notation for 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine?
The canonical SMILES for 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine is Cc1cnc2c(C)onc2n1.
What is the InChIKey of 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine?
The InChIKey is BKTCFJUNKXPNEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-4-3-8-6-5(2)11-10-7(6)9-4/h3H,1-2H3.
What are the key properties of 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine?
3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine has a molecular weight of 149.15 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-[1,2]oxazolo[3,4-b]pyrazine is sourced from PubChem (CID 166898130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).