C19H17ClN2 — CID 59654102
2-chloro-3-methyl-5,6-bis(4-methylphenyl)pyrazine (PubChem CID 59654102) has the molecular formula C19H17ClN2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-chloro-3-methyl-5,6-bis(4-methylphenyl)pyrazine.
| Compound Name | 2-chloro-3-methyl-5,6-bis(4-methylphenyl)pyrazine |
|---|---|
| PubChem CID | 59654102 |
| Molecular Formula | C19H17ClN2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-chloro-3-methyl-5,6-bis(4-methylphenyl)pyrazine |
| SMILES | Cc1ccc(-c2nc(C)c(Cl)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H17ClN2/c1-12-4-8-15(9-5-12)17-18(22-19(20)14(3)21-17)16-10-6-13(2)7-11-16/h4-11H,1-3H3 |
| InChIKey | MTJGGFXYQPVPDN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |