C13H14BrClIN3S — CID 102843967
2-(4-bromo-5-chlorothiophen-2-yl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 102843967) has the molecular formula C13H14BrClIN3S and a molecular weight of 486.60 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102843967 |
| Molecular Formula | C13H14BrClIN3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 484.88 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(-c2cc(Br)c(Cl)s2)nc(NCC)c1I |
| InChI | InChI=1S/C13H14BrClIN3S/c1-3-5-8-10(16)13(17-4-2)19-12(18-8)9-6-7(14)11(15)20-9/h6H,3-5H2,1-2H3,(H,17,18,19) |
| InChIKey | MVWAPMRMEMLCHU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|