C11H10Br2IN3S — CID 102843946
2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 102843946) has the molecular formula C11H10Br2IN3S and a molecular weight of 503.00 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102843946 |
| Molecular Formula | C11H10Br2IN3S |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 500.80 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cc(Br)c(Br)s2)nc(C)c1I |
| InChI | InChI=1S/C11H10Br2IN3S/c1-3-15-11-8(14)5(2)16-10(17-11)7-4-6(12)9(13)18-7/h4H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | UEHQCERRILPZBN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|