C12H13BrFN3S — CID 102843919
2-(4-bromo-5-methylthiophen-2-yl)-N-ethyl-5-fluoro-6-methylpyrimidin-4-amine (PubChem CID 102843919) has the molecular formula C12H13BrFN3S and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-(4-bromo-5-methylthiophen-2-yl)-N-ethyl-5-fluoro-6-methylpyrimidin-4-amine.
| Compound Name | 2-(4-bromo-5-methylthiophen-2-yl)-N-ethyl-5-fluoro-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102843919 |
| Molecular Formula | C12H13BrFN3S |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-(4-bromo-5-methylthiophen-2-yl)-N-ethyl-5-fluoro-6-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cc(Br)c(C)s2)nc(C)c1F |
| InChI | InChI=1S/C12H13BrFN3S/c1-4-15-12-10(14)6(2)16-11(17-12)9-5-8(13)7(3)18-9/h5H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | DIOOBULADQFBAX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |