C15H17Br2N3S — CID 102844082
5-bromo-2-(4-bromo-5-methylthiophen-2-yl)-6-cyclopropyl-N-propylpyrimidin-4-amine (PubChem CID 102844082) has the molecular formula C15H17Br2N3S and a molecular weight of 431.20 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-5-methylthiophen-2-yl)-6-cyclopropyl-N-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4-bromo-5-methylthiophen-2-yl)-6-cyclopropyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102844082 |
| Molecular Formula | C15H17Br2N3S |
| Molecular Weight | 431.20 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | 5-bromo-2-(4-bromo-5-methylthiophen-2-yl)-6-cyclopropyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cc(Br)c(C)s2)nc(C2CC2)c1Br |
| InChI | InChI=1S/C15H17Br2N3S/c1-3-6-18-15-12(17)13(9-4-5-9)19-14(20-15)11-7-10(16)8(2)21-11/h7,9H,3-6H2,1-2H3,(H,18,19,20) |
| InChIKey | IXAQDRXKRORZJY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.20 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |