C9H7Br2FN4S — CID 102844249
[2-(4,5-dibromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 102844249) has the molecular formula C9H7Br2FN4S and a molecular weight of 382.06 g/mol. Its IUPAC name is [2-(4,5-dibromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4,5-dibromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 102844249 |
| Molecular Formula | C9H7Br2FN4S |
| Molecular Weight | 382.06 g/mol |
| Exact Mass | 379.87 |
| IUPAC Name | [2-(4,5-dibromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(-c2cc(Br)c(Br)s2)nc(NN)c1F |
| InChI | InChI=1S/C9H7Br2FN4S/c1-3-6(12)9(16-13)15-8(14-3)5-2-4(10)7(11)17-5/h2H,13H2,1H3,(H,14,15,16) |
| InChIKey | VTIQTHNTTDTMMK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|