C9H8BrFN4S — CID 115381279
[2-(3-bromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 115381279) has the molecular formula C9H8BrFN4S and a molecular weight of 303.16 g/mol. Its IUPAC name is [2-(3-bromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3-bromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 115381279 |
| Molecular Formula | C9H8BrFN4S |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | [2-(3-bromothiophen-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(-c2sccc2Br)nc(NN)c1F |
| InChI | InChI=1S/C9H8BrFN4S/c1-4-6(11)8(15-12)14-9(13-4)7-5(10)2-3-16-7/h2-3H,12H2,1H3,(H,13,14,15) |
| InChIKey | JFZKWWGTVXUIEK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|